C23H17FN4S — CID 139844987
N-[(4-fluorophenyl)methyl]-5-pyridin-4-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine (PubChem CID 139844987) has the molecular formula C23H17FN4S and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-pyridin-4-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-pyridin-4-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine |
|---|---|
| PubChem CID | 139844987 |
| Molecular Formula | C23H17FN4S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-pyridin-4-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine |
| SMILES | Fc1ccc(CNc2nc(-c3ccncc3)nc3sc4c(c23)C2=CCCC24)cc1 |
| InChI | InChI=1S/C23H17FN4S/c24-15-6-4-13(5-7-15)12-26-22-19-18-16-2-1-3-17(16)20(18)29-23(19)28-21(27-22)14-8-10-25-11-9-14/h2,4-11,17H,1,3,12H2,(H,26,27,28) |
| InChIKey | ROEYTSFDDIPJES-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |