C23H16Cl2N4S — CID 139844992
N-[(3,4-dichlorophenyl)methyl]-5-pyridin-2-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine (PubChem CID 139844992) has the molecular formula C23H16Cl2N4S and a molecular weight of 451.38 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-5-pyridin-2-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-5-pyridin-2-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine |
|---|---|
| PubChem CID | 139844992 |
| Molecular Formula | C23H16Cl2N4S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-5-pyridin-2-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine |
| SMILES | Clc1ccc(CNc2nc(-c3ccccn3)nc3sc4c(c23)C2=CCCC24)cc1Cl |
| InChI | InChI=1S/C23H16Cl2N4S/c24-15-8-7-12(10-16(15)25)11-27-22-19-18-13-4-3-5-14(13)20(18)30-23(19)29-21(28-22)17-6-1-2-9-26-17/h1-2,4,6-10,14H,3,5,11H2,(H,27,28,29) |
| InChIKey | KCOCVALXAUOHKS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |