C27H28N2O — CID 139845149
3-[(3S)-1-[2-(4-methylphenyl)ethyl]pyrrolidin-3-yl]-3-phenyl-1H-indol-2-one (PubChem CID 139845149) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is 3-[(3S)-1-[2-(4-methylphenyl)ethyl]pyrrolidin-3-yl]-3-phenyl-1H-indol-2-one.
| Compound Name | 3-[(3S)-1-[2-(4-methylphenyl)ethyl]pyrrolidin-3-yl]-3-phenyl-1H-indol-2-one |
|---|---|
| PubChem CID | 139845149 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 3-[(3S)-1-[2-(4-methylphenyl)ethyl]pyrrolidin-3-yl]-3-phenyl-1H-indol-2-one |
| SMILES | Cc1ccc(CCN2CC[C@@H](C3(c4ccccc4)C(=O)Nc4ccccc43)C2)cc1 |
| InChI | InChI=1S/C27H28N2O/c1-20-11-13-21(14-12-20)15-17-29-18-16-23(19-29)27(22-7-3-2-4-8-22)24-9-5-6-10-25(24)28-26(27)30/h2-14,23H,15-19H2,1H3,(H,28,30)/t23-,27?/m1/s1 |
| InChIKey | KQRJMFFMOBWYRC-BRIWLPCBSA-N |
| XLogP | 4.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |