About 4-(3-methylbutoxy)butyl ethanesulfonate
4-(3-methylbutoxy)butyl ethanesulfonate (PubChem CID 139845470) has the molecular formula C11H24O4S
and a molecular weight of 252.38 g/mol. Its IUPAC name is 4-(3-methylbutoxy)butyl ethanesulfonate.
Molecular Properties
| Compound Name | 4-(3-methylbutoxy)butyl ethanesulfonate |
| PubChem CID | 139845470 |
| Molecular Formula | C11H24O4S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 4-(3-methylbutoxy)butyl ethanesulfonate |
| SMILES | CCS(=O)(=O)OCCCCOCCC(C)C |
| InChI | InChI=1S/C11H24O4S/c1-4-16(12,13)15-9-6-5-8-14-10-7-11(2)3/h11H,4-10H2,1-3H3 |
| InChIKey | QHMQYBRIKBSZBR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylbutoxy)butyl ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutoxy)butyl ethanesulfonate?
The IUPAC name of 4-(3-methylbutoxy)butyl ethanesulfonate (CID 139845470) is 4-(3-methylbutoxy)butyl ethanesulfonate.
What is the SMILES notation for 4-(3-methylbutoxy)butyl ethanesulfonate?
The canonical SMILES for 4-(3-methylbutoxy)butyl ethanesulfonate is CCS(=O)(=O)OCCCCOCCC(C)C.
What is the InChIKey of 4-(3-methylbutoxy)butyl ethanesulfonate?
The InChIKey is QHMQYBRIKBSZBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O4S/c1-4-16(12,13)15-9-6-5-8-14-10-7-11(2)3/h11H,4-10H2,1-3H3.
What are the key properties of 4-(3-methylbutoxy)butyl ethanesulfonate?
4-(3-methylbutoxy)butyl ethanesulfonate has a molecular weight of 252.38 g/mol, XLogP of 2.20, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutoxy)butyl ethanesulfonate is sourced from PubChem (CID 139845470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).