C30H33N3O5 — CID 139845637
(2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[6-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-3-pyridinyl]methylidene]-4-oxobutanoic acid (PubChem CID 139845637) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[6-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-3-pyridinyl]methylidene]-4-oxobutanoic acid.
| Compound Name | (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[6-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-3-pyridinyl]methylidene]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139845637 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[6-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-3-pyridinyl]methylidene]-4-oxobutanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(/C=C(\CC(=O)N2C[C@H]3CCCC[C@H]3C2)C(=O)O)cn1 |
| InChI | InChI=1S/C30H33N3O5/c1-20-26(32-29(38-20)22-7-3-2-4-8-22)13-14-37-27-12-11-21(17-31-27)15-25(30(35)36)16-28(34)33-18-23-9-5-6-10-24(23)19-33/h2-4,7-8,11-12,15,17,23-24H,5-6,9-10,13-14,16,18-19H2,1H3,(H,35,36)/b25-15+/t23-,24+ |
| InChIKey | XZYWPQKYMRMQIT-MUCKSBDESA-N |
| XLogP | 5.17 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|