C34H41N3O5 — CID 139845748
ethyl 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[[4-[2-[(3-methylquinoline-2-carbonyl)amino]ethoxy]phenyl]methyl]-4-oxobutanoate (PubChem CID 139845748) has the molecular formula C34H41N3O5 and a molecular weight of 571.72 g/mol. Its IUPAC name is ethyl 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[[4-[2-[(3-methylquinoline-2-carbonyl)amino]ethoxy]phenyl]methyl]-4-oxobutanoate.
| Compound Name | ethyl 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[[4-[2-[(3-methylquinoline-2-carbonyl)amino]ethoxy]phenyl]methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 139845748 |
| Molecular Formula | C34H41N3O5 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | ethyl 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[[4-[2-[(3-methylquinoline-2-carbonyl)amino]ethoxy]phenyl]methyl]-4-oxobutanoate |
| SMILES | CCOC(=O)C(CC(=O)N1CC2CCCCC2C1)Cc1ccc(OCCNC(=O)c2nc3ccccc3cc2C)cc1 |
| InChI | InChI=1S/C34H41N3O5/c1-3-41-34(40)28(20-31(38)37-21-26-9-4-5-10-27(26)22-37)19-24-12-14-29(15-13-24)42-17-16-35-33(39)32-23(2)18-25-8-6-7-11-30(25)36-32/h6-8,11-15,18,26-28H,3-5,9-10,16-17,19-22H2,1-2H3,(H,35,39) |
| InChIKey | GYTYMGOJTCWSKJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|