C8H13ClN2O2 — CID 139845969
2-methyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione;hydrochloride (PubChem CID 139845969) has the molecular formula C8H13ClN2O2 and a molecular weight of 204.66 g/mol. Its IUPAC name is 2-methyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione;hydrochloride.
| Compound Name | 2-methyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 139845969 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-methyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione;hydrochloride |
| SMILES | CN1C(=O)C2CCNCC2C1=O.Cl |
| InChI | InChI=1S/C8H12N2O2.ClH/c1-10-7(11)5-2-3-9-4-6(5)8(10)12;/h5-6,9H,2-4H2,1H3;1H |
| InChIKey | PKYMFZFWTQNQBI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|