C37H40N4O9S — CID 139846131
ethyl 2-[[2-[[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxymethyl]-6-hydroxy-2,5,7,8-tetramethyl-3H-chromen-4-ylidene]amino]oxyacetate (PubChem CID 139846131) has the molecular formula C37H40N4O9S and a molecular weight of 716.81 g/mol. Its IUPAC name is ethyl 2-[[2-[[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxymethyl]-6-hydroxy-2,5,7,8-tetramethyl-3H-chromen-4-ylidene]amino]oxyacetate.
| Compound Name | ethyl 2-[[2-[[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxymethyl]-6-hydroxy-2,5,7,8-tetramethyl-3H-chromen-4-ylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 139846131 |
| Molecular Formula | C37H40N4O9S |
| Molecular Weight | 716.81 g/mol |
| Exact Mass | 716.25 |
| IUPAC Name | ethyl 2-[[2-[[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxymethyl]-6-hydroxy-2,5,7,8-tetramethyl-3H-chromen-4-ylidene]amino]oxyacetate |
| SMILES | CCOC(=O)CON=C1CC(C)(COc2ccc3nc(COc4ccc(CC5SC(=O)NC5=O)cc4)n(C)c3c2)Oc2c(C)c(C)c(O)c(C)c21 |
| InChI | InChI=1S/C37H40N4O9S/c1-7-46-31(42)18-49-40-27-16-37(5,50-34-21(3)20(2)33(43)22(4)32(27)34)19-48-25-12-13-26-28(15-25)41(6)30(38-26)17-47-24-10-8-23(9-11-24)14-29-35(44)39-36(45)51-29/h8-13,15,29,43H,7,14,16-19H2,1-6H3,(H,39,44,45) |
| InChIKey | OYYBNZAXQXVYMV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 159.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.81 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|