C34H36N4O7S — CID 139846145
5-[[4-[[6-[(6-hydroxy-4-methoxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139846145) has the molecular formula C34H36N4O7S and a molecular weight of 644.75 g/mol. Its IUPAC name is 5-[[4-[[6-[(6-hydroxy-4-methoxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[6-[(6-hydroxy-4-methoxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139846145 |
| Molecular Formula | C34H36N4O7S |
| Molecular Weight | 644.75 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | 5-[[4-[[6-[(6-hydroxy-4-methoxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CON=C1CC(C)(COc2ccc3nc(COc4ccc(CC5SC(=O)NC5=O)cc4)n(C)c3c2)Oc2c(C)c(C)c(O)c(C)c21 |
| InChI | InChI=1S/C34H36N4O7S/c1-18-19(2)31-29(20(3)30(18)39)25(37-42-6)15-34(4,45-31)17-44-23-11-12-24-26(14-23)38(5)28(35-24)16-43-22-9-7-21(8-10-22)13-27-32(40)36-33(41)46-27/h7-12,14,27,39H,13,15-17H2,1-6H3,(H,36,40,41) |
| InChIKey | HNFRTVPEPDXVCI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|