C33H34N4O7S — CID 139846164
5-[[4-[[6-[(6-hydroxy-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139846164) has the molecular formula C33H34N4O7S and a molecular weight of 630.72 g/mol. Its IUPAC name is 5-[[4-[[6-[(6-hydroxy-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[6-[(6-hydroxy-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139846164 |
| Molecular Formula | C33H34N4O7S |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | 5-[[4-[[6-[(6-hydroxy-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(=NO)CC(C)(COc1ccc3nc(COc4ccc(CC5SC(=O)NC5=O)cc4)n(C)c3c1)O2 |
| InChI | InChI=1S/C33H34N4O7S/c1-17-18(2)30-28(19(3)29(17)38)24(36-41)14-33(4,44-30)16-43-22-10-11-23-25(13-22)37(5)27(34-23)15-42-21-8-6-20(7-9-21)12-26-31(39)35-32(40)45-26/h6-11,13,26,38,41H,12,14-16H2,1-5H3,(H,35,39,40) |
| InChIKey | YICSQXASTGLRTM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|