C40H40N4O7S — CID 139846165
5-[[4-[[6-[(6-hydroxy-2,5,7,8-tetramethyl-4-phenylmethoxyimino-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139846165) has the molecular formula C40H40N4O7S and a molecular weight of 720.85 g/mol. Its IUPAC name is 5-[[4-[[6-[(6-hydroxy-2,5,7,8-tetramethyl-4-phenylmethoxyimino-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[6-[(6-hydroxy-2,5,7,8-tetramethyl-4-phenylmethoxyimino-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139846165 |
| Molecular Formula | C40H40N4O7S |
| Molecular Weight | 720.85 g/mol |
| Exact Mass | 720.26 |
| IUPAC Name | 5-[[4-[[6-[(6-hydroxy-2,5,7,8-tetramethyl-4-phenylmethoxyimino-3H-chromen-2-yl)methoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(=NOCc1ccccc1)CC(C)(COc1ccc3nc(COc4ccc(CC5SC(=O)NC5=O)cc4)n(C)c3c1)O2 |
| InChI | InChI=1S/C40H40N4O7S/c1-23-24(2)37-35(25(3)36(23)45)31(43-50-20-27-9-7-6-8-10-27)19-40(4,51-37)22-49-29-15-16-30-32(18-29)44(5)34(41-30)21-48-28-13-11-26(12-14-28)17-33-38(46)42-39(47)52-33/h6-16,18,33,45H,17,19-22H2,1-5H3,(H,42,46,47) |
| InChIKey | CSUDWFWXGWCTHG-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.85 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|