About tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane
tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane (PubChem CID 139847433) has the molecular formula C12H28GeO2
and a molecular weight of 276.96 g/mol. Its IUPAC name is tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane.
Molecular Properties
| Compound Name | tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane |
| PubChem CID | 139847433 |
| Molecular Formula | C12H28GeO2 |
| Molecular Weight | 276.96 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane |
| SMILES | CO[Ge](OC)(C(C)(C)C)C(C)(C)C(C)C |
| InChI | InChI=1S/C12H28GeO2/c1-10(2)12(6,7)13(14-8,15-9)11(3,4)5/h10H,1-9H3 |
| InChIKey | QLPOFBUXPWKPKL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane?
The IUPAC name of tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane (CID 139847433) is tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane.
What is the SMILES notation for tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane?
The canonical SMILES for tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane is CO[Ge](OC)(C(C)(C)C)C(C)(C)C(C)C.
What is the InChIKey of tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane?
The InChIKey is QLPOFBUXPWKPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28GeO2/c1-10(2)12(6,7)13(14-8,15-9)11(3,4)5/h10H,1-9H3.
What are the key properties of tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane?
tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane has a molecular weight of 276.96 g/mol, XLogP of 3.96, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(2,3-dimethylbutan-2-yl)-dimethoxygermane is sourced from PubChem (CID 139847433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).