C28H60N4 — CID 139847650
1,4,7,10-tetrakis(2-methylbutan-2-yl)-1,4,7,10-tetrazacyclododecane (PubChem CID 139847650) has the molecular formula C28H60N4 and a molecular weight of 452.82 g/mol. Its IUPAC name is 1,4,7,10-tetrakis(2-methylbutan-2-yl)-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetrakis(2-methylbutan-2-yl)-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 139847650 |
| Molecular Formula | C28H60N4 |
| Molecular Weight | 452.82 g/mol |
| Exact Mass | 452.48 |
| IUPAC Name | 1,4,7,10-tetrakis(2-methylbutan-2-yl)-1,4,7,10-tetrazacyclododecane |
| SMILES | CCC(C)(C)N1CCN(C(C)(C)CC)CCN(C(C)(C)CC)CCN(C(C)(C)CC)CC1 |
| InChI | InChI=1S/C28H60N4/c1-13-25(5,6)29-17-19-30(26(7,8)14-2)21-23-32(28(11,12)16-4)24-22-31(20-18-29)27(9,10)15-3/h13-24H2,1-12H3 |
| InChIKey | SMJMIMRPDYOWJF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.82 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |