About methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate
methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate (PubChem CID 139847744) has the molecular formula C15H17N3O5
and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate |
| PubChem CID | 139847744 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)ccnc1OCc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C15H17N3O5/c1-9-5-6-16-14(13(9)15(19)22-4)23-8-10-17-11(20-2)7-12(18-10)21-3/h5-7H,8H2,1-4H3 |
| InChIKey | HTHOJAYPUBNPGS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate?
The IUPAC name of methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate (CID 139847744) is methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate.
What is the SMILES notation for methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate?
The canonical SMILES for methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate is COC(=O)c1c(C)ccnc1OCc1nc(OC)cc(OC)n1.
What is the InChIKey of methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate?
The InChIKey is HTHOJAYPUBNPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O5/c1-9-5-6-16-14(13(9)15(19)22-4)23-8-10-17-11(20-2)7-12(18-10)21-3/h5-7H,8H2,1-4H3.
What are the key properties of methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate?
methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate has a molecular weight of 319.32 g/mol, XLogP of 1.56, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4,6-dimethoxypyrimidin-2-yl)methoxy]-4-methylpyridine-3-carboxylate is sourced from PubChem (CID 139847744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).