C29H34F6O — CID 139848787
2-[2,6-difluoro-4-(4-hexylcyclohexyl)phenyl]-5-fluoro-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139848787) has the molecular formula C29H34F6O and a molecular weight of 512.58 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(4-hexylcyclohexyl)phenyl]-5-fluoro-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[2,6-difluoro-4-(4-hexylcyclohexyl)phenyl]-5-fluoro-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139848787 |
| Molecular Formula | C29H34F6O |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 2-[2,6-difluoro-4-(4-hexylcyclohexyl)phenyl]-5-fluoro-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCCC1CCC(c2cc(F)c(C3CCc4c(ccc(OC(F)(F)F)c4F)C3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H34F6O/c1-2-3-4-5-6-18-7-9-19(10-8-18)22-16-24(30)27(25(31)17-22)21-11-13-23-20(15-21)12-14-26(28(23)32)36-29(33,34)35/h12,14,16-19,21H,2-11,13,15H2,1H3 |
| InChIKey | VIMFAKOIROWUMP-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|