C28H32F3N — CID 139849548
1,3-difluoro-6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 139849548) has the molecular formula C28H32F3N and a molecular weight of 439.57 g/mol. Its IUPAC name is 1,3-difluoro-6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 1,3-difluoro-6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139849548 |
| Molecular Formula | C28H32F3N |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1,3-difluoro-6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | CCCCCC1CCC(c2ccc(C3CCc4c(cc(F)c(C#N)c4F)C3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H32F3N/c1-2-3-4-5-18-6-8-19(9-7-18)20-10-12-23(26(29)15-20)21-11-13-24-22(14-21)16-27(30)25(17-32)28(24)31/h10,12,15-16,18-19,21H,2-9,11,13-14H2,1H3 |
| InChIKey | CECDVIBLNBUGPV-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|