About 6-bromo-1,1-difluoro-2H-naphthalen-2-ol
6-bromo-1,1-difluoro-2H-naphthalen-2-ol (PubChem CID 139850138) has the molecular formula C10H7BrF2O
and a molecular weight of 261.07 g/mol. Its IUPAC name is 6-bromo-1,1-difluoro-2H-naphthalen-2-ol.
Molecular Properties
| Compound Name | 6-bromo-1,1-difluoro-2H-naphthalen-2-ol |
| PubChem CID | 139850138 |
| Molecular Formula | C10H7BrF2O |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 6-bromo-1,1-difluoro-2H-naphthalen-2-ol |
| SMILES | OC1C=Cc2cc(Br)ccc2C1(F)F |
| InChI | InChI=1S/C10H7BrF2O/c11-7-2-3-8-6(5-7)1-4-9(14)10(8,12)13/h1-5,9,14H |
| InChIKey | QTSPSEWTVWSBFP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1,1-difluoro-2H-naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,1-difluoro-2H-naphthalen-2-ol?
The IUPAC name of 6-bromo-1,1-difluoro-2H-naphthalen-2-ol (CID 139850138) is 6-bromo-1,1-difluoro-2H-naphthalen-2-ol.
What is the SMILES notation for 6-bromo-1,1-difluoro-2H-naphthalen-2-ol?
The canonical SMILES for 6-bromo-1,1-difluoro-2H-naphthalen-2-ol is OC1C=Cc2cc(Br)ccc2C1(F)F.
What is the InChIKey of 6-bromo-1,1-difluoro-2H-naphthalen-2-ol?
The InChIKey is QTSPSEWTVWSBFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF2O/c11-7-2-3-8-6(5-7)1-4-9(14)10(8,12)13/h1-5,9,14H.
What are the key properties of 6-bromo-1,1-difluoro-2H-naphthalen-2-ol?
6-bromo-1,1-difluoro-2H-naphthalen-2-ol has a molecular weight of 261.07 g/mol, XLogP of 2.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,1-difluoro-2H-naphthalen-2-ol is sourced from PubChem (CID 139850138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).