C31H29F5O — CID 139851065
6-[2-(4-but-3-enylcyclohexyl)ethyl]-1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethynyl]naphthalene (PubChem CID 139851065) has the molecular formula C31H29F5O and a molecular weight of 512.56 g/mol. Its IUPAC name is 6-[2-(4-but-3-enylcyclohexyl)ethyl]-1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethynyl]naphthalene.
| Compound Name | 6-[2-(4-but-3-enylcyclohexyl)ethyl]-1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139851065 |
| Molecular Formula | C31H29F5O |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 6-[2-(4-but-3-enylcyclohexyl)ethyl]-1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethynyl]naphthalene |
| SMILES | C=CCCC1CCC(CCc2ccc3c(F)c(C#Cc4ccc(OC(F)(F)F)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C31H29F5O/c1-2-3-4-21-5-7-22(8-6-21)9-10-23-12-17-27-26(19-23)16-15-25(30(27)33)14-11-24-13-18-29(28(32)20-24)37-31(34,35)36/h2,12-13,15-22H,1,3-10H2 |
| InChIKey | TYJZEWKNWSOMBI-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|