C31H31F5 — CID 139851371
1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-6-(4-hexylcyclohexyl)naphthalene (PubChem CID 139851371) has the molecular formula C31H31F5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-6-(4-hexylcyclohexyl)naphthalene.
| Compound Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-6-(4-hexylcyclohexyl)naphthalene |
|---|---|
| PubChem CID | 139851371 |
| Molecular Formula | C31H31F5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-6-(4-hexylcyclohexyl)naphthalene |
| SMILES | CCCCCCC1CCC(c2ccc3c(F)c(C#Cc4ccc(C(F)(F)F)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C31H31F5/c1-2-3-4-5-6-21-7-11-23(12-8-21)25-16-17-27-26(20-25)15-14-24(30(27)33)13-9-22-10-18-28(29(32)19-22)31(34,35)36/h10,14-21,23H,2-8,11-12H2,1H3 |
| InChIKey | CXVCKIAOLIGBNQ-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|