C29H21F5O — CID 139851505
6-(4-butylphenyl)-2-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-1-fluoronaphthalene (PubChem CID 139851505) has the molecular formula C29H21F5O and a molecular weight of 480.48 g/mol. Its IUPAC name is 6-(4-butylphenyl)-2-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-1-fluoronaphthalene.
| Compound Name | 6-(4-butylphenyl)-2-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139851505 |
| Molecular Formula | C29H21F5O |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 6-(4-butylphenyl)-2-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-1-fluoronaphthalene |
| SMILES | CCCCc1ccc(-c2ccc3c(F)c(C#Cc4cc(F)c(OC(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C29H21F5O/c1-2-3-4-18-5-8-20(9-6-18)22-13-14-24-23(17-22)12-11-21(27(24)32)10-7-19-15-25(30)28(26(31)16-19)35-29(33)34/h5-6,8-9,11-17,29H,2-4H2,1H3 |
| InChIKey | JITCBLOYZZWPEF-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|