C28H30F2N2O7 — CID 139851803
1'-[6-[bis(4-fluorophenyl)methoxy]hexyl]spiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-2,3,6-trione (PubChem CID 139851803) has the molecular formula C28H30F2N2O7 and a molecular weight of 544.55 g/mol. Its IUPAC name is 1'-[6-[bis(4-fluorophenyl)methoxy]hexyl]spiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-2,3,6-trione.
| Compound Name | 1'-[6-[bis(4-fluorophenyl)methoxy]hexyl]spiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-2,3,6-trione |
|---|---|
| PubChem CID | 139851803 |
| Molecular Formula | C28H30F2N2O7 |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 1'-[6-[bis(4-fluorophenyl)methoxy]hexyl]spiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-2,3,6-trione |
| SMILES | O=C1OC2N(OC1=O)C(=O)OC21CCN(CCCCCCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H30F2N2O7/c29-21-9-5-19(6-10-21)23(20-7-11-22(30)12-8-20)36-18-4-2-1-3-15-31-16-13-28(14-17-31)26-32(27(35)38-28)39-25(34)24(33)37-26/h5-12,23,26H,1-4,13-18H2 |
| InChIKey | UYXKUGZEVGXGKN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|