C27H28F2N2O7 — CID 139851804
1'-[5-[bis(4-fluorophenyl)methoxy]pentyl]spiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-2,3,6-trione (PubChem CID 139851804) has the molecular formula C27H28F2N2O7 and a molecular weight of 530.52 g/mol. Its IUPAC name is 1'-[5-[bis(4-fluorophenyl)methoxy]pentyl]spiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-2,3,6-trione.
| Compound Name | 1'-[5-[bis(4-fluorophenyl)methoxy]pentyl]spiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-2,3,6-trione |
|---|---|
| PubChem CID | 139851804 |
| Molecular Formula | C27H28F2N2O7 |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 1'-[5-[bis(4-fluorophenyl)methoxy]pentyl]spiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-2,3,6-trione |
| SMILES | O=C1OC2N(OC1=O)C(=O)OC21CCN(CCCCCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H28F2N2O7/c28-20-8-4-18(5-9-20)22(19-6-10-21(29)11-7-19)35-17-3-1-2-14-30-15-12-27(13-16-30)25-31(26(34)37-27)38-24(33)23(32)36-25/h4-11,22,25H,1-3,12-17H2 |
| InChIKey | FBVHAOUUIHGRRD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|