C14F32O3Si — CID 139851940
tris[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]-(1,1,2,2,2-pentafluoroethyl)silane (PubChem CID 139851940) has the molecular formula C14F32O3Si and a molecular weight of 852.17 g/mol. Its IUPAC name is tris[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]-(1,1,2,2,2-pentafluoroethyl)silane.
| Compound Name | tris[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]-(1,1,2,2,2-pentafluoroethyl)silane |
|---|---|
| PubChem CID | 139851940 |
| Molecular Formula | C14F32O3Si |
| Molecular Weight | 852.17 g/mol |
| Exact Mass | 851.91 |
| IUPAC Name | tris[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]-(1,1,2,2,2-pentafluoroethyl)silane |
| SMILES | FC(F)(F)C(O[Si](OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)(OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14F32O3Si/c15-4(16,17)1(5(18,19)20,6(21,22)23)47-50(14(45,46)13(42,43)44,48-2(7(24,25)26,8(27,28)29)9(30,31)32)49-3(10(33,34)35,11(36,37)38)12(39,40)41 |
| InChIKey | WGTLNLYFGJXQJP-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.17 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|