About 5-(furan-2-yl)-1,3-benzothiazole
5-(furan-2-yl)-1,3-benzothiazole (PubChem CID 139851998) has the molecular formula C11H7NOS
and a molecular weight of 201.25 g/mol. Its IUPAC name is 5-(furan-2-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-(furan-2-yl)-1,3-benzothiazole |
| PubChem CID | 139851998 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 5-(furan-2-yl)-1,3-benzothiazole |
| SMILES | c1coc(-c2ccc3scnc3c2)c1 |
| InChI | InChI=1S/C11H7NOS/c1-2-10(13-5-1)8-3-4-11-9(6-8)12-7-14-11/h1-7H |
| InChIKey | BVOKPPYJIVPMPJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(furan-2-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)-1,3-benzothiazole?
The IUPAC name of 5-(furan-2-yl)-1,3-benzothiazole (CID 139851998) is 5-(furan-2-yl)-1,3-benzothiazole.
What is the SMILES notation for 5-(furan-2-yl)-1,3-benzothiazole?
The canonical SMILES for 5-(furan-2-yl)-1,3-benzothiazole is c1coc(-c2ccc3scnc3c2)c1.
What is the InChIKey of 5-(furan-2-yl)-1,3-benzothiazole?
The InChIKey is BVOKPPYJIVPMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NOS/c1-2-10(13-5-1)8-3-4-11-9(6-8)12-7-14-11/h1-7H.
What are the key properties of 5-(furan-2-yl)-1,3-benzothiazole?
5-(furan-2-yl)-1,3-benzothiazole has a molecular weight of 201.25 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-1,3-benzothiazole is sourced from PubChem (CID 139851998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).