About ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate
ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate (PubChem CID 1398530) has the molecular formula C15H15N3O5
and a molecular weight of 317.30 g/mol. Its IUPAC name is ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate |
| PubChem CID | 1398530 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C(\C)c2c(O)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H15N3O5/c1-3-23-14(21)9-4-6-10(7-5-9)16-8(2)11-12(19)17-15(22)18-13(11)20/h4-7H,3H2,1-2H3,(H3,17,18,19,20,22)/b16-8+ |
| InChIKey | MCSFDUSUOPTLIS-LZYBPNLTSA-N |
| XLogP | 1.09 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate?
The IUPAC name of ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate (CID 1398530) is ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate.
What is the SMILES notation for ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate?
The canonical SMILES for ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate is CCOC(=O)c1ccc(/N=C(\C)c2c(O)[nH]c(=O)[nH]c2=O)cc1.
What is the InChIKey of ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate?
The InChIKey is MCSFDUSUOPTLIS-LZYBPNLTSA-N. The full InChI is InChI=1S/C15H15N3O5/c1-3-23-14(21)9-4-6-10(7-5-9)16-8(2)11-12(19)17-15(22)18-13(11)20/h4-7H,3H2,1-2H3,(H3,17,18,19,20,22)/b16-8+.
What are the key properties of ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate?
ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate has a molecular weight of 317.30 g/mol, XLogP of 1.09, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]benzoate is sourced from PubChem (CID 1398530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).