C27H20F4N2O — CID 139857266
2-[2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-(2-methoxyethyl)pyrimidine (PubChem CID 139857266) has the molecular formula C27H20F4N2O and a molecular weight of 464.46 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-(2-methoxyethyl)pyrimidine.
| Compound Name | 2-[2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-(2-methoxyethyl)pyrimidine |
|---|---|
| PubChem CID | 139857266 |
| Molecular Formula | C27H20F4N2O |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-[2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-(2-methoxyethyl)pyrimidine |
| SMILES | COCCc1cnc(CCc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C27H20F4N2O/c1-34-11-10-19-15-32-25(33-16-19)9-5-18-3-7-20(23(28)13-18)6-2-17-4-8-22-21(12-17)14-24(29)27(31)26(22)30/h3-4,7-8,12-16H,5,9-11H2,1H3 |
| InChIKey | HQSQKYWQOFRHFQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|