C28H22F4N2O — CID 139857602
2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-(3-methoxypropyl)pyrimidine (PubChem CID 139857602) has the molecular formula C28H22F4N2O and a molecular weight of 478.49 g/mol. Its IUPAC name is 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-(3-methoxypropyl)pyrimidine.
| Compound Name | 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-(3-methoxypropyl)pyrimidine |
|---|---|
| PubChem CID | 139857602 |
| Molecular Formula | C28H22F4N2O |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-(3-methoxypropyl)pyrimidine |
| SMILES | COCCCc1cnc(CCc2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C28H22F4N2O/c1-35-12-2-3-20-16-33-27(34-17-20)11-6-19-14-25(30)23(26(31)15-19)9-5-18-4-8-22-21(13-18)7-10-24(29)28(22)32/h4,7-8,10,13-17H,2-3,6,11-12H2,1H3 |
| InChIKey | RGDYCFUIKSGMSJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|