C24H19F3O3 — CID 139858090
2-[3,5-difluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,3-dioxane (PubChem CID 139858090) has the molecular formula C24H19F3O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,3-dioxane.
| Compound Name | 2-[3,5-difluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 139858090 |
| Molecular Formula | C24H19F3O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[3,5-difluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,3-dioxane |
| SMILES | COCC1COC(c2cc(F)c(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)OC1 |
| InChI | InChI=1S/C24H19F3O3/c1-28-12-16-13-29-24(30-14-16)19-10-22(26)21(23(27)11-19)7-3-15-2-4-18-9-20(25)6-5-17(18)8-15/h2,4-6,8-11,16,24H,12-14H2,1H3 |
| InChIKey | JRWAXRNKUDZDMH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|