C28H21F5N2O — CID 139858974
2-[2-[3,5-difluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-(3-methoxypropyl)pyrimidine (PubChem CID 139858974) has the molecular formula C28H21F5N2O and a molecular weight of 496.48 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-(3-methoxypropyl)pyrimidine.
| Compound Name | 2-[2-[3,5-difluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-(3-methoxypropyl)pyrimidine |
|---|---|
| PubChem CID | 139858974 |
| Molecular Formula | C28H21F5N2O |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-(3-methoxypropyl)pyrimidine |
| SMILES | COCCCc1cnc(CCc2cc(F)c(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C28H21F5N2O/c1-36-10-2-3-19-15-34-26(35-16-19)9-6-18-12-23(29)22(24(30)13-18)8-5-17-4-7-21-20(11-17)14-25(31)28(33)27(21)32/h4,7,11-16H,2-3,6,9-10H2,1H3 |
| InChIKey | OTLXXCQLQONRAB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|