About 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one
3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one (PubChem CID 139859706) has the molecular formula C14H15ClFNO4
and a molecular weight of 315.73 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one.
Molecular Properties
| Compound Name | 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one |
| PubChem CID | 139859706 |
| Molecular Formula | C14H15ClFNO4 |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one |
| SMILES | COCON1C(=O)C(c2c(F)cccc2Cl)=C(O)C1(C)C |
| InChI | InChI=1S/C14H15ClFNO4/c1-14(2)12(18)11(13(19)17(14)21-7-20-3)10-8(15)5-4-6-9(10)16/h4-6,18H,7H2,1-3H3 |
| InChIKey | XQWXQNZHTBWDJZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one?
The IUPAC name of 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one (CID 139859706) is 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one.
What is the SMILES notation for 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one?
The canonical SMILES for 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one is COCON1C(=O)C(c2c(F)cccc2Cl)=C(O)C1(C)C.
What is the InChIKey of 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one?
The InChIKey is XQWXQNZHTBWDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClFNO4/c1-14(2)12(18)11(13(19)17(14)21-7-20-3)10-8(15)5-4-6-9(10)16/h4-6,18H,7H2,1-3H3.
What are the key properties of 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one?
3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one has a molecular weight of 315.73 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-6-fluorophenyl)-4-hydroxy-1-(methoxymethoxy)-5,5-dimethylpyrrol-2-one is sourced from PubChem (CID 139859706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).