C12H24N+ — CID 139860318
ethyl-dimethyl-(4-methylhepta-1,6-dien-4-yl)azanium (PubChem CID 139860318) has the molecular formula C12H24N+ and a molecular weight of 182.33 g/mol. Its IUPAC name is ethyl-dimethyl-(4-methylhepta-1,6-dien-4-yl)azanium.
| Compound Name | ethyl-dimethyl-(4-methylhepta-1,6-dien-4-yl)azanium |
|---|---|
| PubChem CID | 139860318 |
| Molecular Formula | C12H24N+ |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.19 |
| IUPAC Name | ethyl-dimethyl-(4-methylhepta-1,6-dien-4-yl)azanium |
| SMILES | C=CCC(C)(CC=C)[N+](C)(C)CC |
| InChI | InChI=1S/C12H24N/c1-7-10-12(4,11-8-2)13(5,6)9-3/h7-8H,1-2,9-11H2,3-6H3/q+1 |
| InChIKey | LYZGOLJJCGOBIO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|