C16H19FO3 — CID 139860405
(2S,5S)-2-(4-fluorophenyl)-5-[(2E,4E)-hexa-2,4-dienoxy]-1,4-dioxane (PubChem CID 139860405) has the molecular formula C16H19FO3 and a molecular weight of 278.32 g/mol. Its IUPAC name is (2S,5S)-2-(4-fluorophenyl)-5-[(2E,4E)-hexa-2,4-dienoxy]-1,4-dioxane.
| Compound Name | (2S,5S)-2-(4-fluorophenyl)-5-[(2E,4E)-hexa-2,4-dienoxy]-1,4-dioxane |
|---|---|
| PubChem CID | 139860405 |
| Molecular Formula | C16H19FO3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2S,5S)-2-(4-fluorophenyl)-5-[(2E,4E)-hexa-2,4-dienoxy]-1,4-dioxane |
| SMILES | C/C=C/C=C/CO[C@@H]1CO[C@@H](c2ccc(F)cc2)CO1 |
| InChI | InChI=1S/C16H19FO3/c1-2-3-4-5-10-18-16-12-19-15(11-20-16)13-6-8-14(17)9-7-13/h2-9,15-16H,10-12H2,1H3/b3-2+,5-4+/t15-,16+/m1/s1 |
| InChIKey | OYFJUFFAKGMLAA-HMZAHUJXSA-N |
| XLogP | 3.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|