C22H27F — CID 139861557
2-(4-but-3-enylcyclohexyl)-6-ethyl-1-fluoronaphthalene (PubChem CID 139861557) has the molecular formula C22H27F and a molecular weight of 310.46 g/mol. Its IUPAC name is 2-(4-but-3-enylcyclohexyl)-6-ethyl-1-fluoronaphthalene.
| Compound Name | 2-(4-but-3-enylcyclohexyl)-6-ethyl-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139861557 |
| Molecular Formula | C22H27F |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-(4-but-3-enylcyclohexyl)-6-ethyl-1-fluoronaphthalene |
| SMILES | C=CCCC1CCC(c2ccc3cc(CC)ccc3c2F)CC1 |
| InChI | InChI=1S/C22H27F/c1-3-5-6-17-7-10-18(11-8-17)20-14-12-19-15-16(4-2)9-13-21(19)22(20)23/h3,9,12-15,17-18H,1,4-8,10-11H2,2H3 |
| InChIKey | XFAGLMPIEFYLNN-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|