C18H14Cl4O3 — CID 139864486
2-[(R)-(2,3-dichlorophenyl)-[(R)-(2,3-dichlorophenyl)-(oxiran-2-yl)methoxy]methyl]oxirane (PubChem CID 139864486) has the molecular formula C18H14Cl4O3 and a molecular weight of 420.12 g/mol. Its IUPAC name is 2-[(R)-(2,3-dichlorophenyl)-[(R)-(2,3-dichlorophenyl)-(oxiran-2-yl)methoxy]methyl]oxirane.
| Compound Name | 2-[(R)-(2,3-dichlorophenyl)-[(R)-(2,3-dichlorophenyl)-(oxiran-2-yl)methoxy]methyl]oxirane |
|---|---|
| PubChem CID | 139864486 |
| Molecular Formula | C18H14Cl4O3 |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | 2-[(R)-(2,3-dichlorophenyl)-[(R)-(2,3-dichlorophenyl)-(oxiran-2-yl)methoxy]methyl]oxirane |
| SMILES | Clc1cccc([C@@H](O[C@H](c2cccc(Cl)c2Cl)C2CO2)C2CO2)c1Cl |
| InChI | InChI=1S/C18H14Cl4O3/c19-11-5-1-3-9(15(11)21)17(13-7-23-13)25-18(14-8-24-14)10-4-2-6-12(20)16(10)22/h1-6,13-14,17-18H,7-8H2/t13?,14?,17-,18-/m1/s1 |
| InChIKey | ZHMYQXRMAFKPNP-VKYMVXLJSA-N |
| XLogP | 5.90 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|