C20H26F2O3 — CID 139865406
methyl 4-(6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3,5-difluorobenzoate (PubChem CID 139865406) has the molecular formula C20H26F2O3 and a molecular weight of 352.42 g/mol. Its IUPAC name is methyl 4-(6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3,5-difluorobenzoate.
| Compound Name | methyl 4-(6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 139865406 |
| Molecular Formula | C20H26F2O3 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | methyl 4-(6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3,5-difluorobenzoate |
| SMILES | CCOC1CCC2CC(c3c(F)cc(C(=O)OC)cc3F)CCC2C1 |
| InChI | InChI=1S/C20H26F2O3/c1-3-25-16-7-6-12-8-14(5-4-13(12)9-16)19-17(21)10-15(11-18(19)22)20(23)24-2/h10-14,16H,3-9H2,1-2H3 |
| InChIKey | QMKRWEGGYJDTSO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |