C28H30ClF3O — CID 139870674
2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-[4-(3-methoxypropyl)cyclohexyl]naphthalene (PubChem CID 139870674) has the molecular formula C28H30ClF3O and a molecular weight of 474.99 g/mol. Its IUPAC name is 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-[4-(3-methoxypropyl)cyclohexyl]naphthalene.
| Compound Name | 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-[4-(3-methoxypropyl)cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139870674 |
| Molecular Formula | C28H30ClF3O |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-[2-(4-chloro-3,5-difluorophenyl)ethyl]-1-fluoro-6-[4-(3-methoxypropyl)cyclohexyl]naphthalene |
| SMILES | COCCCC1CCC(c2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C28H30ClF3O/c1-33-14-2-3-18-4-7-20(8-5-18)22-12-13-24-23(17-22)11-10-21(28(24)32)9-6-19-15-25(30)27(29)26(31)16-19/h10-13,15-18,20H,2-9,14H2,1H3 |
| InChIKey | BXGDCARNVRIYQD-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|