C28H25ClF2O — CID 139871282
2-[2-(4-chloro-3-fluorophenyl)ethyl]-1-fluoro-6-[4-(3-methoxypropyl)phenyl]naphthalene (PubChem CID 139871282) has the molecular formula C28H25ClF2O and a molecular weight of 450.96 g/mol. Its IUPAC name is 2-[2-(4-chloro-3-fluorophenyl)ethyl]-1-fluoro-6-[4-(3-methoxypropyl)phenyl]naphthalene.
| Compound Name | 2-[2-(4-chloro-3-fluorophenyl)ethyl]-1-fluoro-6-[4-(3-methoxypropyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 139871282 |
| Molecular Formula | C28H25ClF2O |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[2-(4-chloro-3-fluorophenyl)ethyl]-1-fluoro-6-[4-(3-methoxypropyl)phenyl]naphthalene |
| SMILES | COCCCc1ccc(-c2ccc3c(F)c(CCc4ccc(Cl)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H25ClF2O/c1-32-16-2-3-19-4-8-21(9-5-19)23-13-14-25-24(18-23)12-11-22(28(25)31)10-6-20-7-15-26(29)27(30)17-20/h4-5,7-9,11-15,17-18H,2-3,6,10,16H2,1H3 |
| InChIKey | KXWTWMDWUCODMY-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|