C31H35F5O2 — CID 139871903
1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-[2-[4-(3-methoxypropyl)cyclohexyl]ethyl]naphthalene (PubChem CID 139871903) has the molecular formula C31H35F5O2 and a molecular weight of 534.61 g/mol. Its IUPAC name is 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-[2-[4-(3-methoxypropyl)cyclohexyl]ethyl]naphthalene.
| Compound Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-[2-[4-(3-methoxypropyl)cyclohexyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139871903 |
| Molecular Formula | C31H35F5O2 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-[2-[4-(3-methoxypropyl)cyclohexyl]ethyl]naphthalene |
| SMILES | COCCCC1CCC(CCc2ccc3c(F)c(CCc4ccc(OC(F)(F)F)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C31H35F5O2/c1-37-18-2-3-21-4-6-22(7-5-21)8-9-23-11-16-27-26(19-23)15-14-25(30(27)33)13-10-24-12-17-29(28(32)20-24)38-31(34,35)36/h11-12,14-17,19-22H,2-10,13,18H2,1H3 |
| InChIKey | ZDEBWCRQLRWNBB-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|