C9H6N2O2S — CID 1398761
(5Z)-5-(pyridin-4-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 1398761) has the molecular formula C9H6N2O2S and a molecular weight of 206.23 g/mol. Its IUPAC name is (5Z)-5-(pyridin-4-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-(pyridin-4-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1398761 |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | (5Z)-5-(pyridin-4-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccncc2)S1 |
| InChI | InChI=1S/C9H6N2O2S/c12-8-7(14-9(13)11-8)5-6-1-3-10-4-2-6/h1-5H,(H,11,12,13)/b7-5- |
| InChIKey | SNBCHQYHZKXQQY-ALCCZGGFSA-N |
| XLogP | 1.41 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|