C13H20O2S — CID 139877750
4-methyl-2-[(1E,3E)-nona-1,3-dienyl]-1,3-oxathiolan-5-one (PubChem CID 139877750) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-methyl-2-[(1E,3E)-nona-1,3-dienyl]-1,3-oxathiolan-5-one.
| Compound Name | 4-methyl-2-[(1E,3E)-nona-1,3-dienyl]-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 139877750 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-methyl-2-[(1E,3E)-nona-1,3-dienyl]-1,3-oxathiolan-5-one |
| SMILES | CCCCC/C=C/C=C/C1OC(=O)C(C)S1 |
| InChI | InChI=1S/C13H20O2S/c1-3-4-5-6-7-8-9-10-12-15-13(14)11(2)16-12/h7-12H,3-6H2,1-2H3/b8-7+,10-9+ |
| InChIKey | KALISRWOHUPOKZ-XBLVEGMJSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|