About 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine
2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine (PubChem CID 139878543) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine |
| PubChem CID | 139878543 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine |
| SMILES | CN(C)C=CS(=O)(=O)C=CN(C)C |
| InChI | InChI=1S/C8H16N2O2S/c1-9(2)5-7-13(11,12)8-6-10(3)4/h5-8H,1-4H3 |
| InChIKey | GIDSONGUTFEKRX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine?
The IUPAC name of 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine (CID 139878543) is 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine.
What is the SMILES notation for 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine?
The canonical SMILES for 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine is CN(C)C=CS(=O)(=O)C=CN(C)C.
What is the InChIKey of 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine?
The InChIKey is GIDSONGUTFEKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2S/c1-9(2)5-7-13(11,12)8-6-10(3)4/h5-8H,1-4H3.
What are the key properties of 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine?
2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine has a molecular weight of 204.29 g/mol, XLogP of 0.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)ethenylsulfonyl]-N,N-dimethylethenamine is sourced from PubChem (CID 139878543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).