C17H21F3N4OSi — CID 139879373
2-[2-[1-(1-ethoxyethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]ethynyl-trimethylsilane (PubChem CID 139879373) has the molecular formula C17H21F3N4OSi and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[2-[1-(1-ethoxyethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]ethynyl-trimethylsilane.
| Compound Name | 2-[2-[1-(1-ethoxyethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 139879373 |
| Molecular Formula | C17H21F3N4OSi |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[2-[1-(1-ethoxyethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]ethynyl-trimethylsilane |
| SMILES | CCOC(C)n1nc(-c2ncccc2C#C[Si](C)(C)C)nc1C(F)(F)F |
| InChI | InChI=1S/C17H21F3N4OSi/c1-6-25-12(2)24-16(17(18,19)20)22-15(23-24)14-13(8-7-10-21-14)9-11-26(3,4)5/h7-8,10,12H,6H2,1-5H3 |
| InChIKey | WWSGHGYZKCHOOW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|