C19H32O6 — CID 139880171
1-[1,3-bis[(E)-prop-1-enoxy]propoxymethoxy]-1,3-bis[(E)-prop-1-enoxy]propane (PubChem CID 139880171) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-[1,3-bis[(E)-prop-1-enoxy]propoxymethoxy]-1,3-bis[(E)-prop-1-enoxy]propane.
| Compound Name | 1-[1,3-bis[(E)-prop-1-enoxy]propoxymethoxy]-1,3-bis[(E)-prop-1-enoxy]propane |
|---|---|
| PubChem CID | 139880171 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-[1,3-bis[(E)-prop-1-enoxy]propoxymethoxy]-1,3-bis[(E)-prop-1-enoxy]propane |
| SMILES | C/C=C/OCCC(O/C=C/C)OCOC(CCO/C=C/C)O/C=C/C |
| InChI | InChI=1S/C19H32O6/c1-5-11-20-15-9-18(22-13-7-3)24-17-25-19(23-14-8-4)10-16-21-12-6-2/h5-8,11-14,18-19H,9-10,15-17H2,1-4H3/b11-5+,12-6+,13-7+,14-8+ |
| InChIKey | JKOYAPKLLIRADB-JRXATRHQSA-N |
| XLogP | 4.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|