C12H20O3S2 — CID 139880192
tert-butyl (3S,5S)-5-acetylsulfanylthiane-3-carboxylate (PubChem CID 139880192) has the molecular formula C12H20O3S2 and a molecular weight of 276.42 g/mol. Its IUPAC name is tert-butyl (3S,5S)-5-acetylsulfanylthiane-3-carboxylate.
| Compound Name | tert-butyl (3S,5S)-5-acetylsulfanylthiane-3-carboxylate |
|---|---|
| PubChem CID | 139880192 |
| Molecular Formula | C12H20O3S2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | tert-butyl (3S,5S)-5-acetylsulfanylthiane-3-carboxylate |
| SMILES | CC(=O)S[C@@H]1CSC[C@H](C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H20O3S2/c1-8(13)17-10-5-9(6-16-7-10)11(14)15-12(2,3)4/h9-10H,5-7H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | OFZONTRYFJOKJP-ZJUUUORDSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|