C36H45N3O6 — CID 139880669
2,4,6-tris(4-phenylmethoxybutoxy)-1,3,5-triazine (PubChem CID 139880669) has the molecular formula C36H45N3O6 and a molecular weight of 615.77 g/mol. Its IUPAC name is 2,4,6-tris(4-phenylmethoxybutoxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-phenylmethoxybutoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 139880669 |
| Molecular Formula | C36H45N3O6 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.33 |
| IUPAC Name | 2,4,6-tris(4-phenylmethoxybutoxy)-1,3,5-triazine |
| SMILES | c1ccc(COCCCCOc2nc(OCCCCOCc3ccccc3)nc(OCCCCOCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C36H45N3O6/c1-4-16-31(17-5-1)28-40-22-10-13-25-43-34-37-35(44-26-14-11-23-41-29-32-18-6-2-7-19-32)39-36(38-34)45-27-15-12-24-42-30-33-20-8-3-9-21-33/h1-9,16-21H,10-15,22-30H2 |
| InChIKey | OIFKVZCLXWDUCM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|