About 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid
5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid (PubChem CID 139880964) has the molecular formula C15H20O5
and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid |
| PubChem CID | 139880964 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid |
| SMILES | CCC=CC=CC1(C)OC(CC(C)O)=C(C(=O)O)C1=O |
| InChI | InChI=1S/C15H20O5/c1-4-5-6-7-8-15(3)13(17)12(14(18)19)11(20-15)9-10(2)16/h5-8,10,16H,4,9H2,1-3H3,(H,18,19) |
| InChIKey | LAGRHJMFPUWOOL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid?
The IUPAC name of 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid (CID 139880964) is 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid.
What is the SMILES notation for 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid?
The canonical SMILES for 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid is CCC=CC=CC1(C)OC(CC(C)O)=C(C(=O)O)C1=O.
What is the InChIKey of 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid?
The InChIKey is LAGRHJMFPUWOOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O5/c1-4-5-6-7-8-15(3)13(17)12(14(18)19)11(20-15)9-10(2)16/h5-8,10,16H,4,9H2,1-3H3,(H,18,19).
What are the key properties of 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid?
5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid has a molecular weight of 280.32 g/mol, XLogP of 1.98, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexa-1,3-dienyl-2-(2-hydroxypropyl)-5-methyl-4-oxofuran-3-carboxylic acid is sourced from PubChem (CID 139880964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).