C16H6F6N2 — CID 139881244
5-[4-(5-amino-2,3,4-trifluorophenyl)buta-1,3-diynyl]-2,3,4-trifluoroaniline (PubChem CID 139881244) has the molecular formula C16H6F6N2 and a molecular weight of 340.23 g/mol. Its IUPAC name is 5-[4-(5-amino-2,3,4-trifluorophenyl)buta-1,3-diynyl]-2,3,4-trifluoroaniline.
| Compound Name | 5-[4-(5-amino-2,3,4-trifluorophenyl)buta-1,3-diynyl]-2,3,4-trifluoroaniline |
|---|---|
| PubChem CID | 139881244 |
| Molecular Formula | C16H6F6N2 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 5-[4-(5-amino-2,3,4-trifluorophenyl)buta-1,3-diynyl]-2,3,4-trifluoroaniline |
| SMILES | Nc1cc(C#CC#Cc2cc(N)c(F)c(F)c2F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H6F6N2/c17-11-7(5-9(23)13(19)15(11)21)3-1-2-4-8-6-10(24)14(20)16(22)12(8)18/h5-6H,23-24H2 |
| InChIKey | IYJLFHKZJFOXQM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|