About 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine
2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine (PubChem CID 139881527) has the molecular formula C21H14F3NO3
and a molecular weight of 385.34 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine |
| PubChem CID | 139881527 |
| Molecular Formula | C21H14F3NO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine |
| SMILES | FC(F)(F)c1ccc(/C=C/c2ccc(Oc3ccc4c(c3)OCO4)nc2)cc1 |
| InChI | InChI=1S/C21H14F3NO3/c22-21(23,24)16-6-3-14(4-7-16)1-2-15-5-10-20(25-12-15)28-17-8-9-18-19(11-17)27-13-26-18/h1-12H,13H2/b2-1+ |
| InChIKey | BQUIMTJKWDJZRL-OWOJBTEDSA-N |
| XLogP | 5.79 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine?
The IUPAC name of 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine (CID 139881527) is 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine?
The canonical SMILES for 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine is FC(F)(F)c1ccc(/C=C/c2ccc(Oc3ccc4c(c3)OCO4)nc2)cc1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine?
The InChIKey is BQUIMTJKWDJZRL-OWOJBTEDSA-N. The full InChI is InChI=1S/C21H14F3NO3/c22-21(23,24)16-6-3-14(4-7-16)1-2-15-5-10-20(25-12-15)28-17-8-9-18-19(11-17)27-13-26-18/h1-12H,13H2/b2-1+.
What are the key properties of 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine?
2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine has a molecular weight of 385.34 g/mol, XLogP of 5.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yloxy)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pyridine is sourced from PubChem (CID 139881527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).