C21H25N5O2S — CID 139881696
tert-butyl 4-(5-cyano-6-methylsulfanyl-2-phenylpyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 139881696) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is tert-butyl 4-(5-cyano-6-methylsulfanyl-2-phenylpyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-cyano-6-methylsulfanyl-2-phenylpyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139881696 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | tert-butyl 4-(5-cyano-6-methylsulfanyl-2-phenylpyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CSc1nc(-c2ccccc2)nc(N2CCN(C(=O)OC(C)(C)C)CC2)c1C#N |
| InChI | InChI=1S/C21H25N5O2S/c1-21(2,3)28-20(27)26-12-10-25(11-13-26)18-16(14-22)19(29-4)24-17(23-18)15-8-6-5-7-9-15/h5-9H,10-13H2,1-4H3 |
| InChIKey | NTDNSEMJMLBNEH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |