C22H18ClF — CID 139883628
2-(4-chlorophenyl)-7-ethyl-3-fluoro-9,10-dihydrophenanthrene (PubChem CID 139883628) has the molecular formula C22H18ClF and a molecular weight of 336.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-ethyl-3-fluoro-9,10-dihydrophenanthrene.
| Compound Name | 2-(4-chlorophenyl)-7-ethyl-3-fluoro-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 139883628 |
| Molecular Formula | C22H18ClF |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(4-chlorophenyl)-7-ethyl-3-fluoro-9,10-dihydrophenanthrene |
| SMILES | CCc1ccc2c(c1)CCc1cc(-c3ccc(Cl)cc3)c(F)cc1-2 |
| InChI | InChI=1S/C22H18ClF/c1-2-14-3-10-19-16(11-14)4-5-17-12-21(22(24)13-20(17)19)15-6-8-18(23)9-7-15/h3,6-13H,2,4-5H2,1H3 |
| InChIKey | PUOOUKKEPXQFOP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |